|
|
Introduced |
 |
|
|
|
|
|
|
|
Description |
|
|
|
 |
|
| |
Synonyms: 2-amino-5-guanidinovaleric acid
Molecular formula: HN: C(NH2)NHCH2CH2CH2CH(CH2)COOH
Cas no: 74-79-3
L-arginine is an essential amino acid that has been heavily researched for the past thirty years. Clinical studies have shown that l-arginine provides a large number of health benefits, and low levels could potentially lead to health problems.
This powerful amino acid helps synthesize nitric oxide, which plays a critical role in blood circulation throughout the body. Clinical studies utilizing 4 grams of l-arginine taken twice daily (8 grams per day) have revealed the following benefits:
Regeneration of organs (heart, kidney, liver, lungs)
Dramatically strengthened the immune system
Improved sleep (promotes deep sleep)
Decreased bodyfat & cellulite
Decreased wrinkles
Improved skin texture and appearance
Increased bone density & reversal of osteoporosis
Increased lean muscle mass
Improved mood and sense of well being
Enhanced libido & sexual performance
Increased energy levels
Improved cholesterol profile |
|
|
|
|
Contact Us |
|
|
|
| |
Company Name: |
|
|
Shandong Baolingbao Biotechnology Co., Ltd. |
| |
Company Address: |
|
|
No. 113, Kaituo Road, Yucheng, Dezhou, Shandong, China |
| |
Telephone: |
|
|
86-534-2126095 |
| |
Full Name (Department): |
|
|
Linda Li () |
|
|
|
|
|
[
